C16H20N4O2 — CID 56894854
N-[(4-hydroxyazepan-4-yl)methyl]quinoxaline-6-carboxamide (PubChem CID 56894854) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is N-[(4-hydroxyazepan-4-yl)methyl]quinoxaline-6-carboxamide.
| Compound Name | N-[(4-hydroxyazepan-4-yl)methyl]quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 56894854 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-[(4-hydroxyazepan-4-yl)methyl]quinoxaline-6-carboxamide |
| SMILES | O=C(NCC1(O)CCCNCC1)c1ccc2nccnc2c1 |
| InChI | InChI=1S/C16H20N4O2/c21-15(20-11-16(22)4-1-6-17-7-5-16)12-2-3-13-14(10-12)19-9-8-18-13/h2-3,8-10,17,22H,1,4-7,11H2,(H,20,21) |
| InChIKey | OSWJYSVAHJVPIY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |