C22H32N2O3 — CID 56885414
3-[1-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]piperidin-4-yl]oxybenzoic acid (PubChem CID 56885414) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is 3-[1-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]piperidin-4-yl]oxybenzoic acid.
| Compound Name | 3-[1-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]piperidin-4-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 56885414 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 3-[1-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]piperidin-4-yl]oxybenzoic acid |
| SMILES | O=C(O)c1cccc(OC2CCN(C[C@@H]3CCCN4CCCC[C@H]34)CC2)c1 |
| InChI | InChI=1S/C22H32N2O3/c25-22(26)17-5-3-7-20(15-17)27-19-9-13-23(14-10-19)16-18-6-4-12-24-11-2-1-8-21(18)24/h3,5,7,15,18-19,21H,1-2,4,6,8-14,16H2,(H,25,26)/t18-,21+/m0/s1 |
| InChIKey | RYFGDOOPXGHTNY-GHTZIAJQSA-N |
| XLogP | 3.49 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |