C14H16F3N5 — CID 56888386
8-[5,6-dimethyl-2-(trifluoromethyl)pyrimidin-4-yl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine (PubChem CID 56888386) has the molecular formula C14H16F3N5 and a molecular weight of 311.31 g/mol. Its IUPAC name is 8-[5,6-dimethyl-2-(trifluoromethyl)pyrimidin-4-yl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine.
| Compound Name | 8-[5,6-dimethyl-2-(trifluoromethyl)pyrimidin-4-yl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine |
|---|---|
| PubChem CID | 56888386 |
| Molecular Formula | C14H16F3N5 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 8-[5,6-dimethyl-2-(trifluoromethyl)pyrimidin-4-yl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine |
| SMILES | Cc1nc(C(F)(F)F)nc(N2CCCn3cncc3C2)c1C |
| InChI | InChI=1S/C14H16F3N5/c1-9-10(2)19-13(14(15,16)17)20-12(9)21-4-3-5-22-8-18-6-11(22)7-21/h6,8H,3-5,7H2,1-2H3 |
| InChIKey | URUPUCJWENZEMF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |