C14H19FN6 — CID 97466934
1-[7-(5-fluoropyrimidin-2-yl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]-N,N-dimethylmethanamine (PubChem CID 97466934) has the molecular formula C14H19FN6 and a molecular weight of 290.35 g/mol. Its IUPAC name is 1-[7-(5-fluoropyrimidin-2-yl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[7-(5-fluoropyrimidin-2-yl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 97466934 |
| Molecular Formula | C14H19FN6 |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 1-[7-(5-fluoropyrimidin-2-yl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1cnc2n1CCN(c1ncc(F)cn1)CC2 |
| InChI | InChI=1S/C14H19FN6/c1-19(2)10-12-9-16-13-3-4-20(5-6-21(12)13)14-17-7-11(15)8-18-14/h7-9H,3-6,10H2,1-2H3 |
| InChIKey | ZFKDRWIGDBLQQS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |