C19H29N3 — CID 56889867
1-[(2,3-dimethyl-1H-indol-7-yl)methyl]-N,N-dimethylazepan-4-amine (PubChem CID 56889867) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 1-[(2,3-dimethyl-1H-indol-7-yl)methyl]-N,N-dimethylazepan-4-amine.
| Compound Name | 1-[(2,3-dimethyl-1H-indol-7-yl)methyl]-N,N-dimethylazepan-4-amine |
|---|---|
| PubChem CID | 56889867 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 1-[(2,3-dimethyl-1H-indol-7-yl)methyl]-N,N-dimethylazepan-4-amine |
| SMILES | Cc1[nH]c2c(CN3CCCC(N(C)C)CC3)cccc2c1C |
| InChI | InChI=1S/C19H29N3/c1-14-15(2)20-19-16(7-5-9-18(14)19)13-22-11-6-8-17(10-12-22)21(3)4/h5,7,9,17,20H,6,8,10-13H2,1-4H3 |
| InChIKey | JZGRNHWVSLILAM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|