C22H28N4 — CID 77087226
2,3-dimethyl-7-[[4-(pyridin-4-ylmethyl)-1,4-diazepan-1-yl]methyl]-1H-indole (PubChem CID 77087226) has the molecular formula C22H28N4 and a molecular weight of 348.49 g/mol. Its IUPAC name is 2,3-dimethyl-7-[[4-(pyridin-4-ylmethyl)-1,4-diazepan-1-yl]methyl]-1H-indole.
| Compound Name | 2,3-dimethyl-7-[[4-(pyridin-4-ylmethyl)-1,4-diazepan-1-yl]methyl]-1H-indole |
|---|---|
| PubChem CID | 77087226 |
| Molecular Formula | C22H28N4 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 2,3-dimethyl-7-[[4-(pyridin-4-ylmethyl)-1,4-diazepan-1-yl]methyl]-1H-indole |
| SMILES | Cc1[nH]c2c(CN3CCCN(Cc4ccncc4)CC3)cccc2c1C |
| InChI | InChI=1S/C22H28N4/c1-17-18(2)24-22-20(5-3-6-21(17)22)16-26-12-4-11-25(13-14-26)15-19-7-9-23-10-8-19/h3,5-10,24H,4,11-16H2,1-2H3 |
| InChIKey | XERQEDZMJCCJBN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|