C18H24N6O2 — CID 56894642
1-[2-amino-4-(3-hydroxypropylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-2-pyridin-2-ylethanone (PubChem CID 56894642) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 1-[2-amino-4-(3-hydroxypropylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-2-pyridin-2-ylethanone.
| Compound Name | 1-[2-amino-4-(3-hydroxypropylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-2-pyridin-2-ylethanone |
|---|---|
| PubChem CID | 56894642 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 1-[2-amino-4-(3-hydroxypropylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-2-pyridin-2-ylethanone |
| SMILES | Nc1nc2c(c(NCCCO)n1)CCN(C(=O)Cc1ccccn1)CC2 |
| InChI | InChI=1S/C18H24N6O2/c19-18-22-15-6-10-24(16(26)12-13-4-1-2-7-20-13)9-5-14(15)17(23-18)21-8-3-11-25/h1-2,4,7,25H,3,5-6,8-12H2,(H3,19,21,22,23) |
| InChIKey | LEVXHSKEFLNWGL-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|