C15H24N8O — CID 56895806
4-N-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 56895806) has the molecular formula C15H24N8O and a molecular weight of 332.41 g/mol. Its IUPAC name is 4-N-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 4-N-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 56895806 |
| Molecular Formula | C15H24N8O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 4-N-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | COCCCn1cnnc1CNc1nc(N)nc2c1CCNCC2 |
| InChI | InChI=1S/C15H24N8O/c1-24-8-2-7-23-10-19-22-13(23)9-18-14-11-3-5-17-6-4-12(11)20-15(16)21-14/h10,17H,2-9H2,1H3,(H3,16,18,20,21) |
| InChIKey | NBZLKDIDSZSDTM-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 115.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|