C18H29N7O — CID 95892161
2-ethyl-N-[(1S)-1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine (PubChem CID 95892161) has the molecular formula C18H29N7O and a molecular weight of 359.48 g/mol. Its IUPAC name is 2-ethyl-N-[(1S)-1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine.
| Compound Name | 2-ethyl-N-[(1S)-1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 95892161 |
| Molecular Formula | C18H29N7O |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | 2-ethyl-N-[(1S)-1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine |
| SMILES | CCc1nc2c(c(N[C@@H](C)c3nncn3CCCOC)n1)CCNCC2 |
| InChI | InChI=1S/C18H29N7O/c1-4-16-22-15-7-9-19-8-6-14(15)17(23-16)21-13(2)18-24-20-12-25(18)10-5-11-26-3/h12-13,19H,4-11H2,1-3H3,(H,21,22,23)/t13-/m0/s1 |
| InChIKey | ISRMVXGGQRTLBJ-ZDUSSCGKSA-N |
| XLogP | 1.53 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|