C13H21N7O — CID 72853296
4-N-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]methyl]-5,6-dimethylpyrimidine-2,4-diamine (PubChem CID 72853296) has the molecular formula C13H21N7O and a molecular weight of 291.36 g/mol. Its IUPAC name is 4-N-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]methyl]-5,6-dimethylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]methyl]-5,6-dimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 72853296 |
| Molecular Formula | C13H21N7O |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 4-N-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]methyl]-5,6-dimethylpyrimidine-2,4-diamine |
| SMILES | COCCCn1cnnc1CNc1nc(N)nc(C)c1C |
| InChI | InChI=1S/C13H21N7O/c1-9-10(2)17-13(14)18-12(9)15-7-11-19-16-8-20(11)5-4-6-21-3/h8H,4-7H2,1-3H3,(H3,14,15,17,18) |
| InChIKey | XXYFTOABWCMKAF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|