C20H30N4O — CID 56898479
3-(2,5-dimethylphenoxy)-N-methyl-N-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-ylmethyl)propan-1-amine (PubChem CID 56898479) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is 3-(2,5-dimethylphenoxy)-N-methyl-N-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-ylmethyl)propan-1-amine.
| Compound Name | 3-(2,5-dimethylphenoxy)-N-methyl-N-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 56898479 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 3-(2,5-dimethylphenoxy)-N-methyl-N-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-ylmethyl)propan-1-amine |
| SMILES | Cc1ccc(C)c(OCCCN(C)Cc2cc3n(n2)CCCNC3)c1 |
| InChI | InChI=1S/C20H30N4O/c1-16-6-7-17(2)20(12-16)25-11-5-9-23(3)15-18-13-19-14-21-8-4-10-24(19)22-18/h6-7,12-13,21H,4-5,8-11,14-15H2,1-3H3 |
| InChIKey | WGLMXPVMJUAIMD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|