C20H28N2O2 — CID 56900212
3-[(3-methoxy-2-prop-2-ynoxyphenyl)methyl]-3,9-diazaspiro[5.5]undecane (PubChem CID 56900212) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 3-[(3-methoxy-2-prop-2-ynoxyphenyl)methyl]-3,9-diazaspiro[5.5]undecane.
| Compound Name | 3-[(3-methoxy-2-prop-2-ynoxyphenyl)methyl]-3,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 56900212 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 3-[(3-methoxy-2-prop-2-ynoxyphenyl)methyl]-3,9-diazaspiro[5.5]undecane |
| SMILES | C#CCOc1c(CN2CCC3(CCNCC3)CC2)cccc1OC |
| InChI | InChI=1S/C20H28N2O2/c1-3-15-24-19-17(5-4-6-18(19)23-2)16-22-13-9-20(10-14-22)7-11-21-12-8-20/h1,4-6,21H,7-16H2,2H3 |
| InChIKey | HGYBCPAQMYHPJP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|