C18H26N2O3 — CID 70765346
2-[(2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[5.5]undecan-3-one (PubChem CID 70765346) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-[(2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 2-[(2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 70765346 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 2-[(2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[5.5]undecan-3-one |
| SMILES | COc1cccc(CN2CC3(CCNCC3)CCC2=O)c1OC |
| InChI | InChI=1S/C18H26N2O3/c1-22-15-5-3-4-14(17(15)23-2)12-20-13-18(7-6-16(20)21)8-10-19-11-9-18/h3-5,19H,6-13H2,1-2H3 |
| InChIKey | JXGZKHXSOUHBTN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |