C13H20N4O3 — CID 56903254
6-(4-aminoazepane-1-carbonyl)-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 56903254) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is 6-(4-aminoazepane-1-carbonyl)-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-(4-aminoazepane-1-carbonyl)-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 56903254 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 6-(4-aminoazepane-1-carbonyl)-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1c(C(=O)N2CCCC(N)CC2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C13H20N4O3/c1-15-10(8-11(18)16(2)13(15)20)12(19)17-6-3-4-9(14)5-7-17/h8-9H,3-7,14H2,1-2H3 |
| InChIKey | OCSLZBQUYRRQCL-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |