C19H24F3N3O — CID 56905869
1-[(1-propylimidazol-2-yl)methyl]-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol (PubChem CID 56905869) has the molecular formula C19H24F3N3O and a molecular weight of 367.42 g/mol. Its IUPAC name is 1-[(1-propylimidazol-2-yl)methyl]-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol.
| Compound Name | 1-[(1-propylimidazol-2-yl)methyl]-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 56905869 |
| Molecular Formula | C19H24F3N3O |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 1-[(1-propylimidazol-2-yl)methyl]-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol |
| SMILES | CCCn1ccnc1CN1CCC(O)(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H24F3N3O/c1-2-9-25-12-8-23-17(25)14-24-10-6-18(26,7-11-24)15-4-3-5-16(13-15)19(20,21)22/h3-5,8,12-13,26H,2,6-7,9-11,14H2,1H3 |
| InChIKey | IXWJMDSUTGQUKD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |