C17H26N4O2S — CID 56908507
(4aS,8aR)-1-butyl-6-[2-(methylamino)-1,3-thiazole-4-carbonyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56908507) has the molecular formula C17H26N4O2S and a molecular weight of 350.49 g/mol. Its IUPAC name is (4aS,8aR)-1-butyl-6-[2-(methylamino)-1,3-thiazole-4-carbonyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-butyl-6-[2-(methylamino)-1,3-thiazole-4-carbonyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56908507 |
| Molecular Formula | C17H26N4O2S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | (4aS,8aR)-1-butyl-6-[2-(methylamino)-1,3-thiazole-4-carbonyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CCCCN1C(=O)CC[C@H]2CN(C(=O)c3csc(NC)n3)CC[C@H]21 |
| InChI | InChI=1S/C17H26N4O2S/c1-3-4-8-21-14-7-9-20(10-12(14)5-6-15(21)22)16(23)13-11-24-17(18-2)19-13/h11-12,14H,3-10H2,1-2H3,(H,18,19)/t12-,14+/m0/s1 |
| InChIKey | SQGPGJDSOWJERL-GXTWGEPZSA-N |
| XLogP | 2.44 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |