C20H30N2O2 — CID 56910815
4-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl-ethylamino]methyl]benzoic acid (PubChem CID 56910815) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 4-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl-ethylamino]methyl]benzoic acid.
| Compound Name | 4-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl-ethylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 56910815 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 4-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl-ethylamino]methyl]benzoic acid |
| SMILES | CCN(Cc1ccc(C(=O)O)cc1)C[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C20H30N2O2/c1-2-21(14-16-8-10-17(11-9-16)20(23)24)15-18-6-5-13-22-12-4-3-7-19(18)22/h8-11,18-19H,2-7,12-15H2,1H3,(H,23,24)/t18-,19+/m0/s1 |
| InChIKey | CVVGHBYPOQFYIO-RBUKOAKNSA-N |
| XLogP | 3.47 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |