C20H28N6O — CID 129490785
N-[[(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-methyl-4-(tetrazol-1-ylmethyl)benzamide (PubChem CID 129490785) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is N-[[(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-methyl-4-(tetrazol-1-ylmethyl)benzamide.
| Compound Name | N-[[(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-methyl-4-(tetrazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 129490785 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | N-[[(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-methyl-4-(tetrazol-1-ylmethyl)benzamide |
| SMILES | CN(C[C@@H]1CCCN2CCCC[C@@H]12)C(=O)c1ccc(Cn2cnnn2)cc1 |
| InChI | InChI=1S/C20H28N6O/c1-24(14-18-5-4-12-25-11-3-2-6-19(18)25)20(27)17-9-7-16(8-10-17)13-26-15-21-22-23-26/h7-10,15,18-19H,2-6,11-14H2,1H3/t18-,19-/m0/s1 |
| InChIKey | RGKJYGWNNAUGDM-OALUTQOASA-N |
| XLogP | 2.06 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |