C19H31N3O2 — CID 56911639
4-[2-(2-methyl-6-propylpyrimidin-4-yl)oxyhex-5-enyl]-1,4-oxazepane (PubChem CID 56911639) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 4-[2-(2-methyl-6-propylpyrimidin-4-yl)oxyhex-5-enyl]-1,4-oxazepane.
| Compound Name | 4-[2-(2-methyl-6-propylpyrimidin-4-yl)oxyhex-5-enyl]-1,4-oxazepane |
|---|---|
| PubChem CID | 56911639 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | 4-[2-(2-methyl-6-propylpyrimidin-4-yl)oxyhex-5-enyl]-1,4-oxazepane |
| SMILES | C=CCCC(CN1CCCOCC1)Oc1cc(CCC)nc(C)n1 |
| InChI | InChI=1S/C19H31N3O2/c1-4-6-9-18(15-22-10-7-12-23-13-11-22)24-19-14-17(8-5-2)20-16(3)21-19/h4,14,18H,1,5-13,15H2,2-3H3 |
| InChIKey | JNNYXOITMNPSPF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|