C20H29N3O — CID 56913069
(3aR,7aS)-2-[2-(6-ethylpyrimidin-4-yl)oxyhex-5-enyl]-1,3,3a,4,7,7a-hexahydroisoindole (PubChem CID 56913069) has the molecular formula C20H29N3O and a molecular weight of 327.47 g/mol. Its IUPAC name is (3aR,7aS)-2-[2-(6-ethylpyrimidin-4-yl)oxyhex-5-enyl]-1,3,3a,4,7,7a-hexahydroisoindole.
| Compound Name | (3aR,7aS)-2-[2-(6-ethylpyrimidin-4-yl)oxyhex-5-enyl]-1,3,3a,4,7,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 56913069 |
| Molecular Formula | C20H29N3O |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | (3aR,7aS)-2-[2-(6-ethylpyrimidin-4-yl)oxyhex-5-enyl]-1,3,3a,4,7,7a-hexahydroisoindole |
| SMILES | C=CCCC(CN1C[C@H]2CC=CC[C@H]2C1)Oc1cc(CC)ncn1 |
| InChI | InChI=1S/C20H29N3O/c1-3-5-10-19(24-20-11-18(4-2)21-15-22-20)14-23-12-16-8-6-7-9-17(16)13-23/h3,6-7,11,15-17,19H,1,4-5,8-10,12-14H2,2H3/t16-,17+,19? |
| InChIKey | ANQUIYXBILMOHE-JJTKIYQPSA-N |
| XLogP | 3.65 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|