C19H27N3O — CID 56900667
(3aR,7aS)-2-[2-(2-methylpyrimidin-4-yl)oxyhex-5-enyl]-1,3,3a,4,7,7a-hexahydroisoindole (PubChem CID 56900667) has the molecular formula C19H27N3O and a molecular weight of 313.45 g/mol. Its IUPAC name is (3aR,7aS)-2-[2-(2-methylpyrimidin-4-yl)oxyhex-5-enyl]-1,3,3a,4,7,7a-hexahydroisoindole.
| Compound Name | (3aR,7aS)-2-[2-(2-methylpyrimidin-4-yl)oxyhex-5-enyl]-1,3,3a,4,7,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 56900667 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | (3aR,7aS)-2-[2-(2-methylpyrimidin-4-yl)oxyhex-5-enyl]-1,3,3a,4,7,7a-hexahydroisoindole |
| SMILES | C=CCCC(CN1C[C@H]2CC=CC[C@H]2C1)Oc1ccnc(C)n1 |
| InChI | InChI=1S/C19H27N3O/c1-3-4-9-18(23-19-10-11-20-15(2)21-19)14-22-12-16-7-5-6-8-17(16)13-22/h3,5-6,10-11,16-18H,1,4,7-9,12-14H2,2H3/t16-,17+,18? |
| InChIKey | XIXRRUUFYFRKAC-JWTNVVGKSA-N |
| XLogP | 3.40 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|