C13H17N3O — CID 56900164
(3aS,7aR)-2-(4-methoxypyrimidin-2-yl)-1,3,3a,4,7,7a-hexahydroisoindole (PubChem CID 56900164) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is (3aS,7aR)-2-(4-methoxypyrimidin-2-yl)-1,3,3a,4,7,7a-hexahydroisoindole.
| Compound Name | (3aS,7aR)-2-(4-methoxypyrimidin-2-yl)-1,3,3a,4,7,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 56900164 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | (3aS,7aR)-2-(4-methoxypyrimidin-2-yl)-1,3,3a,4,7,7a-hexahydroisoindole |
| SMILES | COc1ccnc(N2C[C@H]3CC=CC[C@H]3C2)n1 |
| InChI | InChI=1S/C13H17N3O/c1-17-12-6-7-14-13(15-12)16-8-10-4-2-3-5-11(10)9-16/h2-3,6-7,10-11H,4-5,8-9H2,1H3/t10-,11+ |
| InChIKey | IVYZGWVOFZBLCH-PHIMTYICSA-N |
| XLogP | 1.89 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|