C15H24F2N2O — CID 177057544
4-[(4,4-difluorocyclohexyl)methoxy]-6-ethylpyrimidine;ethane (PubChem CID 177057544) has the molecular formula C15H24F2N2O and a molecular weight of 286.37 g/mol. Its IUPAC name is 4-[(4,4-difluorocyclohexyl)methoxy]-6-ethylpyrimidine;ethane.
| Compound Name | 4-[(4,4-difluorocyclohexyl)methoxy]-6-ethylpyrimidine;ethane |
|---|---|
| PubChem CID | 177057544 |
| Molecular Formula | C15H24F2N2O |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 4-[(4,4-difluorocyclohexyl)methoxy]-6-ethylpyrimidine;ethane |
| SMILES | CC.CCc1cc(OCC2CCC(F)(F)CC2)ncn1 |
| InChI | InChI=1S/C13H18F2N2O.C2H6/c1-2-11-7-12(17-9-16-11)18-8-10-3-5-13(14,15)6-4-10;1-2/h7,9-10H,2-6,8H2,1H3;1-2H3 |
| InChIKey | RTCQQPPZLBHDLM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |