C18H22N4O2S — CID 56912045
4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-1-ethylpyrrole-2-carbonitrile (PubChem CID 56912045) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-1-ethylpyrrole-2-carbonitrile.
| Compound Name | 4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-1-ethylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 56912045 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-1-ethylpyrrole-2-carbonitrile |
| SMILES | CCn1cc(CN2CCN(S(=O)(=O)c3ccccc3)CC2)cc1C#N |
| InChI | InChI=1S/C18H22N4O2S/c1-2-21-15-16(12-17(21)13-19)14-20-8-10-22(11-9-20)25(23,24)18-6-4-3-5-7-18/h3-7,12,15H,2,8-11,14H2,1H3 |
| InChIKey | BKFBUKQPEAYLQZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |