C16H19N3O2S — CID 56918490
3-[2-(2-butyl-2,5-dihydropyrrol-1-yl)-2-oxoethyl]thieno[3,2-d]pyrimidin-4-one (PubChem CID 56918490) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 3-[2-(2-butyl-2,5-dihydropyrrol-1-yl)-2-oxoethyl]thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-[2-(2-butyl-2,5-dihydropyrrol-1-yl)-2-oxoethyl]thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 56918490 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 3-[2-(2-butyl-2,5-dihydropyrrol-1-yl)-2-oxoethyl]thieno[3,2-d]pyrimidin-4-one |
| SMILES | CCCCC1C=CCN1C(=O)Cn1cnc2ccsc2c1=O |
| InChI | InChI=1S/C16H19N3O2S/c1-2-3-5-12-6-4-8-19(12)14(20)10-18-11-17-13-7-9-22-15(13)16(18)21/h4,6-7,9,11-12H,2-3,5,8,10H2,1H3 |
| InChIKey | IKOGZSOZTGDVOY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|