C33H30N2O3 — CID 56925509
ethyl 2-[3-[2-(5-ethyl-3,4-diphenylpyrazol-1-yl)phenyl]phenoxy]acetate (PubChem CID 56925509) has the molecular formula C33H30N2O3 and a molecular weight of 504.61 g/mol. Its IUPAC name is ethyl 2-[3-[2-(5-ethyl-3,4-diphenylpyrazol-1-yl)phenyl]phenoxy]acetate.
| Compound Name | ethyl 2-[3-[2-(5-ethyl-3,4-diphenylpyrazol-1-yl)phenyl]phenoxy]acetate |
|---|---|
| PubChem CID | 56925509 |
| Molecular Formula | C33H30N2O3 |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | ethyl 2-[3-[2-(5-ethyl-3,4-diphenylpyrazol-1-yl)phenyl]phenoxy]acetate |
| SMILES | CCOC(=O)[14CH2]Oc1cccc(-c2ccccc2-n2nc(-c3ccccc3)c(-c3ccccc3)c2CC)c1 |
| InChI | InChI=1S/C33H30N2O3/c1-3-29-32(24-14-7-5-8-15-24)33(25-16-9-6-10-17-25)34-35(29)30-21-12-11-20-28(30)26-18-13-19-27(22-26)38-23-31(36)37-4-2/h5-22H,3-4,23H2,1-2H3/i23+2 |
| InChIKey | ADVYDDCPSQJVEB-DQBITZTASA-N |
| XLogP | 7.38 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |