C18H14FN5O — CID 56929078
(4-fluorophenyl)-[4-(1H-imidazol-5-ylamino)quinazolin-2-yl]methanol (PubChem CID 56929078) has the molecular formula C18H14FN5O and a molecular weight of 335.34 g/mol. Its IUPAC name is (4-fluorophenyl)-[4-(1H-imidazol-5-ylamino)quinazolin-2-yl]methanol.
| Compound Name | (4-fluorophenyl)-[4-(1H-imidazol-5-ylamino)quinazolin-2-yl]methanol |
|---|---|
| PubChem CID | 56929078 |
| Molecular Formula | C18H14FN5O |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | (4-fluorophenyl)-[4-(1H-imidazol-5-ylamino)quinazolin-2-yl]methanol |
| SMILES | OC(c1ccc(F)cc1)c1nc(Nc2cnc[nH]2)c2ccccc2n1 |
| InChI | InChI=1S/C18H14FN5O/c19-12-7-5-11(6-8-12)16(25)18-22-14-4-2-1-3-13(14)17(24-18)23-15-9-20-10-21-15/h1-10,16,25H,(H,20,21)(H,22,23,24) |
| InChIKey | CBMHGKQGANFFNA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |