C19H21ClN2O3 — CID 56930064
ethyl (E)-3-[5-chloro-2-[(3,5,6-trimethylpyrazin-2-yl)methoxy]phenyl]prop-2-enoate (PubChem CID 56930064) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is ethyl (E)-3-[5-chloro-2-[(3,5,6-trimethylpyrazin-2-yl)methoxy]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[5-chloro-2-[(3,5,6-trimethylpyrazin-2-yl)methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 56930064 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | ethyl (E)-3-[5-chloro-2-[(3,5,6-trimethylpyrazin-2-yl)methoxy]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc(Cl)ccc1OCc1nc(C)c(C)nc1C |
| InChI | InChI=1S/C19H21ClN2O3/c1-5-24-19(23)9-6-15-10-16(20)7-8-18(15)25-11-17-14(4)21-12(2)13(3)22-17/h6-10H,5,11H2,1-4H3/b9-6+ |
| InChIKey | RHHVRYDIPMNLSW-RMKNXTFCSA-N |
| XLogP | 4.21 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|