C18H18Cl2N2O3 — CID 86618814
ethyl (E)-3-[4-(2,4-dichlorophenoxy)-2-propan-2-ylpyrimidin-5-yl]prop-2-enoate (PubChem CID 86618814) has the molecular formula C18H18Cl2N2O3 and a molecular weight of 381.26 g/mol. Its IUPAC name is ethyl (E)-3-[4-(2,4-dichlorophenoxy)-2-propan-2-ylpyrimidin-5-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-(2,4-dichlorophenoxy)-2-propan-2-ylpyrimidin-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 86618814 |
| Molecular Formula | C18H18Cl2N2O3 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | ethyl (E)-3-[4-(2,4-dichlorophenoxy)-2-propan-2-ylpyrimidin-5-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cnc(C(C)C)nc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H18Cl2N2O3/c1-4-24-16(23)8-5-12-10-21-17(11(2)3)22-18(12)25-15-7-6-13(19)9-14(15)20/h5-11H,4H2,1-3H3/b8-5+ |
| InChIKey | PTALWQBKOQDITO-VMPITWQZSA-N |
| XLogP | 5.28 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|