C18H34O6Si — CID 56930227
(4S)-4-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxan-5-one (PubChem CID 56930227) has the molecular formula C18H34O6Si and a molecular weight of 374.55 g/mol. Its IUPAC name is (4S)-4-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxan-5-one.
| Compound Name | (4S)-4-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxan-5-one |
|---|---|
| PubChem CID | 56930227 |
| Molecular Formula | C18H34O6Si |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (4S)-4-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxan-5-one |
| SMILES | CC1(C)O[C@@H]([C@@H]2OC(C)(C)OCC2=O)[C@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C18H34O6Si/c1-16(2,3)25(8,9)21-11-13-15(24-18(6,7)22-13)14-12(19)10-20-17(4,5)23-14/h13-15H,10-11H2,1-9H3/t13-,14+,15+/m0/s1 |
| InChIKey | UPXNZENLXOSJCG-RRFJBIMHSA-N |
| XLogP | 3.25 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|