C17H13N3O4S2 — CID 56930780
2-(1,3-dioxoisoindol-2-yl)-N-(4-oxo-2-thiophen-2-yl-1,3-thiazolidin-3-yl)acetamide (PubChem CID 56930780) has the molecular formula C17H13N3O4S2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(4-oxo-2-thiophen-2-yl-1,3-thiazolidin-3-yl)acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(4-oxo-2-thiophen-2-yl-1,3-thiazolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 56930780 |
| Molecular Formula | C17H13N3O4S2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(4-oxo-2-thiophen-2-yl-1,3-thiazolidin-3-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)NN1C(=O)CSC1c1cccs1 |
| InChI | InChI=1S/C17H13N3O4S2/c21-13(8-19-15(23)10-4-1-2-5-11(10)16(19)24)18-20-14(22)9-26-17(20)12-6-3-7-25-12/h1-7,17H,8-9H2,(H,18,21) |
| InChIKey | ZMJUDILSEWPUEY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|