C18H21N3O3 — CID 56930846
ethyl 2-[1-(tert-butylamino)-3,3-dicyano-1-oxopropan-2-yl]benzoate (PubChem CID 56930846) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is ethyl 2-[1-(tert-butylamino)-3,3-dicyano-1-oxopropan-2-yl]benzoate.
| Compound Name | ethyl 2-[1-(tert-butylamino)-3,3-dicyano-1-oxopropan-2-yl]benzoate |
|---|---|
| PubChem CID | 56930846 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | ethyl 2-[1-(tert-butylamino)-3,3-dicyano-1-oxopropan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccccc1C(C(=O)NC(C)(C)C)C(C#N)C#N |
| InChI | InChI=1S/C18H21N3O3/c1-5-24-17(23)14-9-7-6-8-13(14)15(12(10-19)11-20)16(22)21-18(2,3)4/h6-9,12,15H,5H2,1-4H3,(H,21,22) |
| InChIKey | VZCRELNLYVZAFO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |