C31H35FN3O9P — CID 56931131
methyl 2-[[[(2R,3R,4S,5R)-4-fluoro-3-hydroxy-5-[2-oxo-6-(4-pentylphenyl)furo[2,3-d]pyrimidin-3-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate (PubChem CID 56931131) has the molecular formula C31H35FN3O9P and a molecular weight of 643.61 g/mol. Its IUPAC name is methyl 2-[[[(2R,3R,4S,5R)-4-fluoro-3-hydroxy-5-[2-oxo-6-(4-pentylphenyl)furo[2,3-d]pyrimidin-3-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate.
| Compound Name | methyl 2-[[[(2R,3R,4S,5R)-4-fluoro-3-hydroxy-5-[2-oxo-6-(4-pentylphenyl)furo[2,3-d]pyrimidin-3-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate |
|---|---|
| PubChem CID | 56931131 |
| Molecular Formula | C31H35FN3O9P |
| Molecular Weight | 643.61 g/mol |
| Exact Mass | 643.21 |
| IUPAC Name | methyl 2-[[[(2R,3R,4S,5R)-4-fluoro-3-hydroxy-5-[2-oxo-6-(4-pentylphenyl)furo[2,3-d]pyrimidin-3-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate |
| SMILES | CCCCCc1ccc(-c2cc3cn([C@@H]4O[C@H](COP(=O)(NCC(=O)OC)Oc5ccccc5)[C@@H](O)[C@@H]4F)c(=O)nc3o2)cc1 |
| InChI | InChI=1S/C31H35FN3O9P/c1-3-4-6-9-20-12-14-21(15-13-20)24-16-22-18-35(31(38)34-29(22)42-24)30-27(32)28(37)25(43-30)19-41-45(39,33-17-26(36)40-2)44-23-10-7-5-8-11-23/h5,7-8,10-16,18,25,27-28,30,37H,3-4,6,9,17,19H2,1-2H3,(H,33,39)/t25-,27+,28-,30-,45?/m1/s1 |
| InChIKey | MKRXUFMXPVZJDK-UGUQILFVSA-N |
| XLogP | 4.95 |
| TPSA | 151.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|