C20H25N4O10P — CID 91584413
methyl 3-[[[(2R,3S,4R,5R)-5-(3-carbamoyl-2-oxopyrazin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 91584413) has the molecular formula C20H25N4O10P and a molecular weight of 512.41 g/mol. Its IUPAC name is methyl 3-[[[(2R,3S,4R,5R)-5-(3-carbamoyl-2-oxopyrazin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl 3-[[[(2R,3S,4R,5R)-5-(3-carbamoyl-2-oxopyrazin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 91584413 |
| Molecular Formula | C20H25N4O10P |
| Molecular Weight | 512.41 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | methyl 3-[[[(2R,3S,4R,5R)-5-(3-carbamoyl-2-oxopyrazin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)CCNP(=O)(OC[C@H]1O[C@@H](n2ccnc(C(N)=O)c2=O)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C20H25N4O10P/c1-31-14(25)7-8-23-35(30,34-12-5-3-2-4-6-12)32-11-13-16(26)17(27)20(33-13)24-10-9-22-15(18(21)28)19(24)29/h2-6,9-10,13,16-17,20,26-27H,7-8,11H2,1H3,(H2,21,28)(H,23,30)/t13-,16-,17-,20-,35?/m1/s1 |
| InChIKey | ZJIDBOAEVWOLEZ-GVESFTNNSA-N |
| XLogP | -0.68 |
| TPSA | 201.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.41 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|