C21H23NO2 — CID 56931733
N-[(R)-[(1R,2R)-2-methyl-6-oxocyclohexyl]-phenylmethyl]benzamide (PubChem CID 56931733) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[(R)-[(1R,2R)-2-methyl-6-oxocyclohexyl]-phenylmethyl]benzamide.
| Compound Name | N-[(R)-[(1R,2R)-2-methyl-6-oxocyclohexyl]-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 56931733 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N-[(R)-[(1R,2R)-2-methyl-6-oxocyclohexyl]-phenylmethyl]benzamide |
| SMILES | C[C@@H]1CCCC(=O)[C@H]1[C@@H](NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO2/c1-15-9-8-14-18(23)19(15)20(16-10-4-2-5-11-16)22-21(24)17-12-6-3-7-13-17/h2-7,10-13,15,19-20H,8-9,14H2,1H3,(H,22,24)/t15-,19+,20+/m1/s1 |
| InChIKey | NKXVMRUCXKFBOY-XPGWFJOJSA-N |
| XLogP | 4.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |