C28H30ClNO6 — CID 56932497
[3-(chloromethyl)-2-methoxy-4-[2-[2-(3-methoxy-4-phenylmethoxyphenyl)ethylamino]-2-oxoethyl]phenyl] acetate (PubChem CID 56932497) has the molecular formula C28H30ClNO6 and a molecular weight of 512.00 g/mol. Its IUPAC name is [3-(chloromethyl)-2-methoxy-4-[2-[2-(3-methoxy-4-phenylmethoxyphenyl)ethylamino]-2-oxoethyl]phenyl] acetate.
| Compound Name | [3-(chloromethyl)-2-methoxy-4-[2-[2-(3-methoxy-4-phenylmethoxyphenyl)ethylamino]-2-oxoethyl]phenyl] acetate |
|---|---|
| PubChem CID | 56932497 |
| Molecular Formula | C28H30ClNO6 |
| Molecular Weight | 512.00 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | [3-(chloromethyl)-2-methoxy-4-[2-[2-(3-methoxy-4-phenylmethoxyphenyl)ethylamino]-2-oxoethyl]phenyl] acetate |
| SMILES | COc1cc(CCNC(=O)Cc2ccc(OC(C)=O)c(OC)c2CCl)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H30ClNO6/c1-19(31)36-25-12-10-22(23(17-29)28(25)34-3)16-27(32)30-14-13-20-9-11-24(26(15-20)33-2)35-18-21-7-5-4-6-8-21/h4-12,15H,13-14,16-18H2,1-3H3,(H,30,32) |
| InChIKey | FFRNEBZBDMFUDD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.00 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|