C29H32ClNO6 — CID 56932498
[3-(chloromethyl)-2-methoxy-4-[2-[2-(3-methoxy-4-phenylmethoxyphenyl)ethylamino]-2-oxoethyl]phenyl] propanoate (PubChem CID 56932498) has the molecular formula C29H32ClNO6 and a molecular weight of 526.03 g/mol. Its IUPAC name is [3-(chloromethyl)-2-methoxy-4-[2-[2-(3-methoxy-4-phenylmethoxyphenyl)ethylamino]-2-oxoethyl]phenyl] propanoate.
| Compound Name | [3-(chloromethyl)-2-methoxy-4-[2-[2-(3-methoxy-4-phenylmethoxyphenyl)ethylamino]-2-oxoethyl]phenyl] propanoate |
|---|---|
| PubChem CID | 56932498 |
| Molecular Formula | C29H32ClNO6 |
| Molecular Weight | 526.03 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | [3-(chloromethyl)-2-methoxy-4-[2-[2-(3-methoxy-4-phenylmethoxyphenyl)ethylamino]-2-oxoethyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(CC(=O)NCCc2ccc(OCc3ccccc3)c(OC)c2)c(CCl)c1OC |
| InChI | InChI=1S/C29H32ClNO6/c1-4-28(33)37-25-13-11-22(23(18-30)29(25)35-3)17-27(32)31-15-14-20-10-12-24(26(16-20)34-2)36-19-21-8-6-5-7-9-21/h5-13,16H,4,14-15,17-19H2,1-3H3,(H,31,32) |
| InChIKey | DADGWGKJOCUFRL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.03 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|