C17H16ClFN2O4S — CID 56933017
7-[(3-chlorophenyl)sulfonylamino]-3-fluoro-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 56933017) has the molecular formula C17H16ClFN2O4S and a molecular weight of 398.84 g/mol. Its IUPAC name is 7-[(3-chlorophenyl)sulfonylamino]-3-fluoro-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | 7-[(3-chlorophenyl)sulfonylamino]-3-fluoro-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 56933017 |
| Molecular Formula | C17H16ClFN2O4S |
| Molecular Weight | 398.84 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 7-[(3-chlorophenyl)sulfonylamino]-3-fluoro-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | O=C(NO)c1cc2c(cc1F)CCC(NS(=O)(=O)c1cccc(Cl)c1)C2 |
| InChI | InChI=1S/C17H16ClFN2O4S/c18-12-2-1-3-14(9-12)26(24,25)21-13-5-4-10-8-16(19)15(17(22)20-23)7-11(10)6-13/h1-3,7-9,13,21,23H,4-6H2,(H,20,22) |
| InChIKey | XDXDDYHADXAFDK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.84 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|