C13H16O5 — CID 56934135
methyl (1R,4S,8S,9S)-9-ethenyl-2-oxo-5,10-dioxatricyclo[6.2.1.04,9]undecane-8-carboxylate (PubChem CID 56934135) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is methyl (1R,4S,8S,9S)-9-ethenyl-2-oxo-5,10-dioxatricyclo[6.2.1.04,9]undecane-8-carboxylate.
| Compound Name | methyl (1R,4S,8S,9S)-9-ethenyl-2-oxo-5,10-dioxatricyclo[6.2.1.04,9]undecane-8-carboxylate |
|---|---|
| PubChem CID | 56934135 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | methyl (1R,4S,8S,9S)-9-ethenyl-2-oxo-5,10-dioxatricyclo[6.2.1.04,9]undecane-8-carboxylate |
| SMILES | C=C[C@]12O[C@@H]3C[C@@]1(C(=O)OC)CCO[C@H]2CC3=O |
| InChI | InChI=1S/C13H16O5/c1-3-13-10-6-8(14)9(18-13)7-12(13,4-5-17-10)11(15)16-2/h3,9-10H,1,4-7H2,2H3/t9-,10+,12-,13-/m1/s1 |
| InChIKey | DMWUDOXEAHWDLP-LYIQGSDWSA-N |
| XLogP | 0.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|