C22H20O8 — CID 124921773
dimethyl (1R,2S,3R,4S,5R,6S,10R,11R,12R,13S,14R,15S)-7,18-dioxo-19,20-dioxanonacyclo[13.3.1.16,10.01,15.02,12.03,14.04,11.05,13.06,10]icosane-12,13-dicarboxylate (PubChem CID 124921773) has the molecular formula C22H20O8 and a molecular weight of 412.39 g/mol. Its IUPAC name is dimethyl (1R,2S,3R,4S,5R,6S,10R,11R,12R,13S,14R,15S)-7,18-dioxo-19,20-dioxanonacyclo[13.3.1.16,10.01,15.02,12.03,14.04,11.05,13.06,10]icosane-12,13-dicarboxylate.
| Compound Name | dimethyl (1R,2S,3R,4S,5R,6S,10R,11R,12R,13S,14R,15S)-7,18-dioxo-19,20-dioxanonacyclo[13.3.1.16,10.01,15.02,12.03,14.04,11.05,13.06,10]icosane-12,13-dicarboxylate |
|---|---|
| PubChem CID | 124921773 |
| Molecular Formula | C22H20O8 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | dimethyl (1R,2S,3R,4S,5R,6S,10R,11R,12R,13S,14R,15S)-7,18-dioxo-19,20-dioxanonacyclo[13.3.1.16,10.01,15.02,12.03,14.04,11.05,13.06,10]icosane-12,13-dicarboxylate |
| SMILES | COC(=O)[C@@]12[C@H]3[C@@H]4[C@@H]5[C@H]([C@]1(C(=O)OC)[C@@H]4[C@]14O[C@]31CCC4=O)[C@@]13CCC(=O)[C@@]1(O3)[C@@H]52 |
| InChI | InChI=1S/C22H20O8/c1-27-15(25)19-11-9-10-12(18-6-4-7(23)21(18,30-18)13(10)19)20(19,16(26)28-2)14(9)22-8(24)3-5-17(11,22)29-22/h9-14H,3-6H2,1-2H3/t9-,10+,11-,12-,13-,14+,17+,18-,19-,20+,21+,22-/m0/s1 |
| InChIKey | OKIWCPAREPOUJH-QRCJEQKESA-N |
| XLogP | -0.19 |
| TPSA | 111.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|