C23H26O8 — CID 125035644
CID 125035644 (PubChem CID 125035644) has the molecular formula C23H26O8 and a molecular weight of 430.45 g/mol.
| Compound Name | CID 125035644 |
|---|---|
| PubChem CID | 125035644 |
| Molecular Formula | C23H26O8 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@@]12C[C@@]3(C(=O)OC)[C@@H]4C[C@]5(CCC(=O)O5)[C@H]1[C@H]4[C@@H]1[C@@H]3[C@@]3(CCC(=O)O3)C[C@@H]12 |
| InChI | InChI=1S/C23H26O8/c1-28-18(26)22-9-23(19(27)29-2)11-8-20(5-3-12(24)30-20)16(22)15(11)14-10(22)7-21(17(14)23)6-4-13(25)31-21/h10-11,14-17H,3-9H2,1-2H3/t10-,11+,14-,15-,16-,17-,20-,21-,22-,23-/m1/s1 |
| InChIKey | QUPYCPXBIYTYNR-OPSHOLEYSA-N |
| XLogP | 1.39 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|