About CID 117069744
CID 117069744 (PubChem CID 117069744) has the molecular formula C23H26O6
and a molecular weight of 398.46 g/mol.
Molecular Properties
| Compound Name | CID 117069744 |
| PubChem CID | 117069744 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | — |
| SMILES | COC(=O)C12CC3(C(=O)OC)C4CC5(CCC5=O)C1C4C1C2CC2(CCC2=O)C13 |
| InChI | InChI=1S/C23H26O6/c1-28-18(26)22-9-23(19(27)29-2)11-8-20(5-3-12(20)24)16(22)15(11)14-10(22)7-21(17(14)23)6-4-13(21)25/h10-11,14-17H,3-9H2,1-2H3 |
| InChIKey | QZNJWIXIRVWASA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 117069744 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 117069744?
The IUPAC name of CID 117069744 (CID 117069744) is not available.
What is the SMILES notation for CID 117069744?
The canonical SMILES for CID 117069744 is COC(=O)C12CC3(C(=O)OC)C4CC5(CCC5=O)C1C4C1C2CC2(CCC2=O)C13.
What is the InChIKey of CID 117069744?
The InChIKey is QZNJWIXIRVWASA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26O6/c1-28-18(26)22-9-23(19(27)29-2)11-8-20(5-3-12(20)24)16(22)15(11)14-10(22)7-21(17(14)23)6-4-13(21)25/h10-11,14-17H,3-9H2,1-2H3.
What are the key properties of CID 117069744?
CID 117069744 has a molecular weight of 398.46 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 117069744 is sourced from PubChem (CID 117069744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).