C11H13NOS2 — CID 56935285
(4S)-3-(2-hydroxyethyl)-4-phenyl-1,3-thiazolidine-2-thione (PubChem CID 56935285) has the molecular formula C11H13NOS2 and a molecular weight of 239.36 g/mol. Its IUPAC name is (4S)-3-(2-hydroxyethyl)-4-phenyl-1,3-thiazolidine-2-thione.
| Compound Name | (4S)-3-(2-hydroxyethyl)-4-phenyl-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 56935285 |
| Molecular Formula | C11H13NOS2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | (4S)-3-(2-hydroxyethyl)-4-phenyl-1,3-thiazolidine-2-thione |
| SMILES | OCCN1C(=S)SC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C11H13NOS2/c13-7-6-12-10(8-15-11(12)14)9-4-2-1-3-5-9/h1-5,10,13H,6-8H2/t10-/m1/s1 |
| InChIKey | UKNFCESXDAIKAL-SNVBAGLBSA-N |
| XLogP | 2.05 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|