C21H28N8O3S — CID 56942420
6-[5-(1-butan-2-ylsulfonylpiperidin-4-yl)-1,2,4-oxadiazol-3-yl]-2-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 56942420) has the molecular formula C21H28N8O3S and a molecular weight of 472.58 g/mol. Its IUPAC name is 6-[5-(1-butan-2-ylsulfonylpiperidin-4-yl)-1,2,4-oxadiazol-3-yl]-2-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[5-(1-butan-2-ylsulfonylpiperidin-4-yl)-1,2,4-oxadiazol-3-yl]-2-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 56942420 |
| Molecular Formula | C21H28N8O3S |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 6-[5-(1-butan-2-ylsulfonylpiperidin-4-yl)-1,2,4-oxadiazol-3-yl]-2-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCC(C)S(=O)(=O)N1CCC(c2nc(-c3nc(N)nc(N(C)c4ccccc4)n3)no2)CC1 |
| InChI | InChI=1S/C21H28N8O3S/c1-4-14(2)33(30,31)29-12-10-15(11-13-29)19-23-18(27-32-19)17-24-20(22)26-21(25-17)28(3)16-8-6-5-7-9-16/h5-9,14-15H,4,10-13H2,1-3H3,(H2,22,24,25,26) |
| InChIKey | XDTBJNMQQVEHKA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 144.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |