C17H23N3O3S — CID 56728016
5-[1-(benzenesulfonyl)piperidin-4-yl]-3-butan-2-yl-1,2,4-oxadiazole (PubChem CID 56728016) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 5-[1-(benzenesulfonyl)piperidin-4-yl]-3-butan-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-[1-(benzenesulfonyl)piperidin-4-yl]-3-butan-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 56728016 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 5-[1-(benzenesulfonyl)piperidin-4-yl]-3-butan-2-yl-1,2,4-oxadiazole |
| SMILES | CCC(C)c1noc(C2CCN(S(=O)(=O)c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C17H23N3O3S/c1-3-13(2)16-18-17(23-19-16)14-9-11-20(12-10-14)24(21,22)15-7-5-4-6-8-15/h4-8,13-14H,3,9-12H2,1-2H3 |
| InChIKey | FXHHLCOMHFZJFJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |