C36H42S2Si2 — CID 56943190
tert-butyl-[2-[12-[2-[tert-butyl(dimethyl)silyl]ethynyl]-7,17-dimethyl-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaen-2-yl]ethynyl]-dimethylsilane (PubChem CID 56943190) has the molecular formula C36H42S2Si2 and a molecular weight of 595.04 g/mol. Its IUPAC name is tert-butyl-[2-[12-[2-[tert-butyl(dimethyl)silyl]ethynyl]-7,17-dimethyl-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaen-2-yl]ethynyl]-dimethylsilane.
| Compound Name | tert-butyl-[2-[12-[2-[tert-butyl(dimethyl)silyl]ethynyl]-7,17-dimethyl-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaen-2-yl]ethynyl]-dimethylsilane |
|---|---|
| PubChem CID | 56943190 |
| Molecular Formula | C36H42S2Si2 |
| Molecular Weight | 595.04 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | tert-butyl-[2-[12-[2-[tert-butyl(dimethyl)silyl]ethynyl]-7,17-dimethyl-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaen-2-yl]ethynyl]-dimethylsilane |
| SMILES | Cc1cc2cc3c(C#C[Si](C)(C)C(C)(C)C)c4cc5sc(C)cc5cc4c(C#C[Si](C)(C)C(C)(C)C)c3cc2s1 |
| InChI | InChI=1S/C36H42S2Si2/c1-23-17-25-19-29-27(13-15-39(9,10)35(3,4)5)32-22-34-26(18-24(2)38-34)20-30(32)28(31(29)21-33(25)37-23)14-16-40(11,12)36(6,7)8/h17-22H,1-12H3 |
| InChIKey | GDFHEOAEKCBTKR-UHFFFAOYSA-N |
| XLogP | 11.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.04 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|