C32H27FO2S — CID 129120015
7-fluoro-2,12-bis(3-methoxy-3-methylbut-1-ynyl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene (PubChem CID 129120015) has the molecular formula C32H27FO2S and a molecular weight of 494.63 g/mol. Its IUPAC name is 7-fluoro-2,12-bis(3-methoxy-3-methylbut-1-ynyl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene.
| Compound Name | 7-fluoro-2,12-bis(3-methoxy-3-methylbut-1-ynyl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 129120015 |
| Molecular Formula | C32H27FO2S |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 7-fluoro-2,12-bis(3-methoxy-3-methylbut-1-ynyl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene |
| SMILES | COC(C)(C)C#Cc1c2cc3ccccc3cc2c(C#CC(C)(C)OC)c2cc3sc(F)cc3cc12 |
| InChI | InChI=1S/C32H27FO2S/c1-31(2,34-5)13-11-23-25-15-20-9-7-8-10-21(20)16-26(25)24(12-14-32(3,4)35-6)28-19-29-22(17-27(23)28)18-30(33)36-29/h7-10,15-19H,1-6H3 |
| InChIKey | BWDXSYKKEJIVAH-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|