C36H38Si2 — CID 173015130
2-methylbutan-2-yl-[2-[13-[2-(2-methylbutan-2-ylsilyl)ethynyl]pentacen-6-yl]ethynyl]silane (PubChem CID 173015130) has the molecular formula C36H38Si2 and a molecular weight of 526.87 g/mol. Its IUPAC name is 2-methylbutan-2-yl-[2-[13-[2-(2-methylbutan-2-ylsilyl)ethynyl]pentacen-6-yl]ethynyl]silane.
| Compound Name | 2-methylbutan-2-yl-[2-[13-[2-(2-methylbutan-2-ylsilyl)ethynyl]pentacen-6-yl]ethynyl]silane |
|---|---|
| PubChem CID | 173015130 |
| Molecular Formula | C36H38Si2 |
| Molecular Weight | 526.87 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | 2-methylbutan-2-yl-[2-[13-[2-(2-methylbutan-2-ylsilyl)ethynyl]pentacen-6-yl]ethynyl]silane |
| SMILES | CCC(C)(C)[SiH2]C#Cc1c2cc3ccccc3cc2c(C#C[SiH2]C(C)(C)CC)c2cc3ccccc3cc12 |
| InChI | InChI=1S/C36H38Si2/c1-7-35(3,4)37-19-17-29-31-21-25-13-9-11-15-27(25)23-33(31)30(18-20-38-36(5,6)8-2)34-24-28-16-12-10-14-26(28)22-32(29)34/h9-16,21-24H,7-8,37-38H2,1-6H3 |
| InChIKey | MWBCLWZOLBLMKE-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.87 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|