C42H40O2S — CID 129120028
7-(4-tert-butylphenyl)-2,12-bis(3-methoxy-3-methylbut-1-ynyl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene (PubChem CID 129120028) has the molecular formula C42H40O2S and a molecular weight of 608.85 g/mol. Its IUPAC name is 7-(4-tert-butylphenyl)-2,12-bis(3-methoxy-3-methylbut-1-ynyl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene.
| Compound Name | 7-(4-tert-butylphenyl)-2,12-bis(3-methoxy-3-methylbut-1-ynyl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 129120028 |
| Molecular Formula | C42H40O2S |
| Molecular Weight | 608.85 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | 7-(4-tert-butylphenyl)-2,12-bis(3-methoxy-3-methylbut-1-ynyl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene |
| SMILES | COC(C)(C)C#Cc1c2cc3ccccc3cc2c(C#CC(C)(C)OC)c2cc3sc(-c4ccc(C(C)(C)C)cc4)cc3cc12 |
| InChI | InChI=1S/C42H40O2S/c1-40(2,3)31-16-14-27(15-17-31)38-25-30-24-36-32(18-20-41(4,5)43-8)34-22-28-12-10-11-13-29(28)23-35(34)33(19-21-42(6,7)44-9)37(36)26-39(30)45-38/h10-17,22-26H,1-9H3 |
| InChIKey | XKZYGTQMECHFMV-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.85 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|