C50H56O2S2 — CID 129119971
7-(4-tert-butylphenyl)sulfanyl-2,12-bis(3-methoxy-4-methyl-3-propan-2-ylpent-1-ynyl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene (PubChem CID 129119971) has the molecular formula C50H56O2S2 and a molecular weight of 753.13 g/mol. Its IUPAC name is 7-(4-tert-butylphenyl)sulfanyl-2,12-bis(3-methoxy-4-methyl-3-propan-2-ylpent-1-ynyl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene.
| Compound Name | 7-(4-tert-butylphenyl)sulfanyl-2,12-bis(3-methoxy-4-methyl-3-propan-2-ylpent-1-ynyl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 129119971 |
| Molecular Formula | C50H56O2S2 |
| Molecular Weight | 753.13 g/mol |
| Exact Mass | 752.37 |
| IUPAC Name | 7-(4-tert-butylphenyl)sulfanyl-2,12-bis(3-methoxy-4-methyl-3-propan-2-ylpent-1-ynyl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene |
| SMILES | COC(C#Cc1c2cc3ccccc3cc2c(C#CC(OC)(C(C)C)C(C)C)c2cc3sc(Sc4ccc(C(C)(C)C)cc4)cc3cc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C50H56O2S2/c1-31(2)49(51-12,32(3)4)24-22-40-42-26-35-16-14-15-17-36(35)27-43(42)41(23-25-50(52-13,33(5)6)34(7)8)45-30-46-37(28-44(40)45)29-47(54-46)53-39-20-18-38(19-21-39)48(9,10)11/h14-21,26-34H,1-13H3 |
| InChIKey | PNYZJEUGTBWZDO-UHFFFAOYSA-N |
| XLogP | 13.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.13 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|